C16H24Cl2N6O2 — CID 88863307
tert-butyl 4-[2-[(2,6-dichloro-5-methanimidoylpyrimidin-4-yl)amino]ethyl]piperazine-1-carboxylate (PubChem CID 88863307) has the molecular formula C16H24Cl2N6O2 and a molecular weight of 403.31 g/mol. Its IUPAC name is tert-butyl 4-[2-[(2,6-dichloro-5-methanimidoylpyrimidin-4-yl)amino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(2,6-dichloro-5-methanimidoylpyrimidin-4-yl)amino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 88863307 |
| Molecular Formula | C16H24Cl2N6O2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | tert-butyl 4-[2-[(2,6-dichloro-5-methanimidoylpyrimidin-4-yl)amino]ethyl]piperazine-1-carboxylate |
| SMILES | [H]/N=C/c1c(Cl)nc(Cl)nc1NCCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H24Cl2N6O2/c1-16(2,3)26-15(25)24-8-6-23(7-9-24)5-4-20-13-11(10-19)12(17)21-14(18)22-13/h10,19H,4-9H2,1-3H3,(H,20,21,22)/b19-10+ |
| InChIKey | ACGVZACKBFXRIQ-VXLYETTFSA-N |
| XLogP | 2.75 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|