C21H18N6O2 — CID 88864707
N-(3,4-dimethoxyphenyl)-5-isocyano-4-(5-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine (PubChem CID 88864707) has the molecular formula C21H18N6O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-5-isocyano-4-(5-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine.
| Compound Name | N-(3,4-dimethoxyphenyl)-5-isocyano-4-(5-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 88864707 |
| Molecular Formula | C21H18N6O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-5-isocyano-4-(5-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine |
| SMILES | [C-]#[N+]c1cnc(Nc2ccc(OC)c(OC)c2)nc1-c1c[nH]c2ncc(C)cc12 |
| InChI | InChI=1S/C21H18N6O2/c1-12-7-14-15(10-24-20(14)23-9-12)19-16(22-2)11-25-21(27-19)26-13-5-6-17(28-3)18(8-13)29-4/h5-11H,1,3-4H3,(H,23,24)(H,25,26,27) |
| InChIKey | YHDVFPYBIOPLJE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|