About 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene
9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene (PubChem CID 88865288) has the molecular formula C30H15F12OP
and a molecular weight of 650.40 g/mol. Its IUPAC name is 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene.
Molecular Properties
| Compound Name | 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene |
| PubChem CID | 88865288 |
| Molecular Formula | C30H15F12OP |
| Molecular Weight | 650.40 g/mol |
| Exact Mass | 650.07 |
| IUPAC Name | 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene |
| SMILES | O=P(c1cc(C(F)(F)F)ccc1C(F)(F)F)(c1cc(C(F)(F)F)ccc1C(F)(F)F)c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C30H15F12OP/c31-27(32,33)17-9-11-22(29(37,38)39)25(14-17)44(43,26-15-18(28(34,35)36)10-12-23(26)30(40,41)42)24-13-16-5-1-2-6-19(16)20-7-3-4-8-21(20)24/h1-15H |
| InChIKey | JCYHFIXYRKDEJI-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 650.40 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene?
The IUPAC name of 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene (CID 88865288) is 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene.
What is the SMILES notation for 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene?
The canonical SMILES for 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene is O=P(c1cc(C(F)(F)F)ccc1C(F)(F)F)(c1cc(C(F)(F)F)ccc1C(F)(F)F)c1cc2ccccc2c2ccccc12.
What is the InChIKey of 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene?
The InChIKey is JCYHFIXYRKDEJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H15F12OP/c31-27(32,33)17-9-11-22(29(37,38)39)25(14-17)44(43,26-15-18(28(34,35)36)10-12-23(26)30(40,41)42)24-13-16-5-1-2-6-19(16)20-7-3-4-8-21(20)24/h1-15H.
What are the key properties of 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene?
9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene has a molecular weight of 650.40 g/mol, XLogP of 9.71, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene is sourced from PubChem (CID 88865288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).