C30H15F12OP — CID 88865288
9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene (PubChem CID 88865288) has the molecular formula C30H15F12OP and a molecular weight of 650.40 g/mol. Its IUPAC name is 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene.
| Compound Name | 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene |
|---|---|
| PubChem CID | 88865288 |
| Molecular Formula | C30H15F12OP |
| Molecular Weight | 650.40 g/mol |
| Exact Mass | 650.07 |
| IUPAC Name | 9-bis[2,5-bis(trifluoromethyl)phenyl]phosphorylphenanthrene |
| SMILES | O=P(c1cc(C(F)(F)F)ccc1C(F)(F)F)(c1cc(C(F)(F)F)ccc1C(F)(F)F)c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C30H15F12OP/c31-27(32,33)17-9-11-22(29(37,38)39)25(14-17)44(43,26-15-18(28(34,35)36)10-12-23(26)30(40,41)42)24-13-16-5-1-2-6-19(16)20-7-3-4-8-21(20)24/h1-15H |
| InChIKey | JCYHFIXYRKDEJI-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.40 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|