C26H9F10OP — CID 88865047
9-bis(2,3,4,5,6-pentafluorophenyl)phosphorylphenanthrene (PubChem CID 88865047) has the molecular formula C26H9F10OP and a molecular weight of 558.31 g/mol. Its IUPAC name is 9-bis(2,3,4,5,6-pentafluorophenyl)phosphorylphenanthrene.
| Compound Name | 9-bis(2,3,4,5,6-pentafluorophenyl)phosphorylphenanthrene |
|---|---|
| PubChem CID | 88865047 |
| Molecular Formula | C26H9F10OP |
| Molecular Weight | 558.31 g/mol |
| Exact Mass | 558.02 |
| IUPAC Name | 9-bis(2,3,4,5,6-pentafluorophenyl)phosphorylphenanthrene |
| SMILES | O=P(c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C26H9F10OP/c27-15-17(29)21(33)25(22(34)18(15)30)38(37,26-23(35)19(31)16(28)20(32)24(26)36)14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H |
| InChIKey | RSAAWUXOPSSONQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.31 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|