About 3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene
3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene (PubChem CID 172559214) has the molecular formula C18H11F4OP
and a molecular weight of 350.25 g/mol. Its IUPAC name is 3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene.
Molecular Properties
| Compound Name | 3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene |
| PubChem CID | 172559214 |
| Molecular Formula | C18H11F4OP |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C18H11F4OP/c19-14-11-15(20)17(22)18(16(14)21)24(23,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11H |
| InChIKey | JAHXYQCZUDXQTE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene?
The IUPAC name of 3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene (CID 172559214) is 3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene.
What is the SMILES notation for 3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene?
The canonical SMILES for 3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene is O=P(c1ccccc1)(c1ccccc1)c1c(F)c(F)cc(F)c1F.
What is the InChIKey of 3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene?
The InChIKey is JAHXYQCZUDXQTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F4OP/c19-14-11-15(20)17(22)18(16(14)21)24(23,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11H.
What are the key properties of 3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene?
3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene has a molecular weight of 350.25 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diphenylphosphoryl-1,2,4,5-tetrafluorobenzene is sourced from PubChem (CID 172559214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).