C34H28O4P2 — CID 102312802
4,5-bis(diphenylphosphoryl)-1,3,6,8-tetrahydrofuro[3,4-e][2]benzofuran (PubChem CID 102312802) has the molecular formula C34H28O4P2 and a molecular weight of 562.54 g/mol. Its IUPAC name is 4,5-bis(diphenylphosphoryl)-1,3,6,8-tetrahydrofuro[3,4-e][2]benzofuran.
| Compound Name | 4,5-bis(diphenylphosphoryl)-1,3,6,8-tetrahydrofuro[3,4-e][2]benzofuran |
|---|---|
| PubChem CID | 102312802 |
| Molecular Formula | C34H28O4P2 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 4,5-bis(diphenylphosphoryl)-1,3,6,8-tetrahydrofuro[3,4-e][2]benzofuran |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1c2c(c3c(c1P(=O)(c1ccccc1)c1ccccc1)COC3)COC2 |
| InChI | InChI=1S/C34H28O4P2/c35-39(25-13-5-1-6-14-25,26-15-7-2-8-16-26)33-31-23-37-21-29(31)30-22-38-24-32(30)34(33)40(36,27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20H,21-24H2 |
| InChIKey | IXJYZLUAMOWORE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|