C16H15N2O2P — CID 102307113
4-diphenylphosphoryl-5-methyl-1,2-dihydropyrazol-3-one (PubChem CID 102307113) has the molecular formula C16H15N2O2P and a molecular weight of 298.28 g/mol. Its IUPAC name is 4-diphenylphosphoryl-5-methyl-1,2-dihydropyrazol-3-one.
| Compound Name | 4-diphenylphosphoryl-5-methyl-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 102307113 |
| Molecular Formula | C16H15N2O2P |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 4-diphenylphosphoryl-5-methyl-1,2-dihydropyrazol-3-one |
| SMILES | Cc1[nH][nH]c(=O)c1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15N2O2P/c1-12-15(16(19)18-17-12)21(20,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11H,1H3,(H2,17,18,19) |
| InChIKey | VVQBLKFPTXJYMC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|