C16H22N2OS — CID 88865469
N-[[2,4-dimethyl-3-(2-sulfanylideneethylideneamino)phenyl]methyl]-2,2-dimethylpropanamide (PubChem CID 88865469) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is N-[[2,4-dimethyl-3-(2-sulfanylideneethylideneamino)phenyl]methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[[2,4-dimethyl-3-(2-sulfanylideneethylideneamino)phenyl]methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 88865469 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-[[2,4-dimethyl-3-(2-sulfanylideneethylideneamino)phenyl]methyl]-2,2-dimethylpropanamide |
| SMILES | Cc1ccc(CNC(=O)C(C)(C)C)c(C)c1/N=C/C=S |
| InChI | InChI=1S/C16H22N2OS/c1-11-6-7-13(10-18-15(19)16(3,4)5)12(2)14(11)17-8-9-20/h6-9H,10H2,1-5H3,(H,18,19)/b17-8+ |
| InChIKey | IXZPVDIXRNLZMT-CAOOACKPSA-N |
| XLogP | 3.67 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|