C12H13F3N2O2 — CID 90019133
2,6-dimethyl-3-[[(2,2,2-trifluoroacetyl)amino]methyl]benzamide (PubChem CID 90019133) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2,6-dimethyl-3-[[(2,2,2-trifluoroacetyl)amino]methyl]benzamide.
| Compound Name | 2,6-dimethyl-3-[[(2,2,2-trifluoroacetyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 90019133 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2,6-dimethyl-3-[[(2,2,2-trifluoroacetyl)amino]methyl]benzamide |
| SMILES | Cc1ccc(CNC(=O)C(F)(F)F)c(C)c1C(N)=O |
| InChI | InChI=1S/C12H13F3N2O2/c1-6-3-4-8(7(2)9(6)10(16)18)5-17-11(19)12(13,14)15/h3-4H,5H2,1-2H3,(H2,16,18)(H,17,19) |
| InChIKey | RCAIGRJGQLVPLZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |