C13H14F2N2OS — CID 88538964
[3-[(2,2-dimethylpropanoylamino)methyl]-2,6-difluorophenyl] thiocyanate (PubChem CID 88538964) has the molecular formula C13H14F2N2OS and a molecular weight of 284.33 g/mol. Its IUPAC name is [3-[(2,2-dimethylpropanoylamino)methyl]-2,6-difluorophenyl] thiocyanate.
| Compound Name | [3-[(2,2-dimethylpropanoylamino)methyl]-2,6-difluorophenyl] thiocyanate |
|---|---|
| PubChem CID | 88538964 |
| Molecular Formula | C13H14F2N2OS |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | [3-[(2,2-dimethylpropanoylamino)methyl]-2,6-difluorophenyl] thiocyanate |
| SMILES | CC(C)(C)C(=O)NCc1ccc(F)c(SC#N)c1F |
| InChI | InChI=1S/C13H14F2N2OS/c1-13(2,3)12(18)17-6-8-4-5-9(14)11(10(8)15)19-7-16/h4-5H,6H2,1-3H3,(H,17,18) |
| InChIKey | UWWVFFDWBCUKIW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|