C18H21F3N6O2 — CID 88865618
N-hydroxy-2-[7-[4-(trifluoromethyl)-2-pyridinyl]-3,7-diazabicyclo[3.3.1]nonan-3-yl]-1,4-dihydropyrimidine-5-carboxamide (PubChem CID 88865618) has the molecular formula C18H21F3N6O2 and a molecular weight of 410.40 g/mol. Its IUPAC name is N-hydroxy-2-[7-[4-(trifluoromethyl)-2-pyridinyl]-3,7-diazabicyclo[3.3.1]nonan-3-yl]-1,4-dihydropyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[7-[4-(trifluoromethyl)-2-pyridinyl]-3,7-diazabicyclo[3.3.1]nonan-3-yl]-1,4-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 88865618 |
| Molecular Formula | C18H21F3N6O2 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-hydroxy-2-[7-[4-(trifluoromethyl)-2-pyridinyl]-3,7-diazabicyclo[3.3.1]nonan-3-yl]-1,4-dihydropyrimidine-5-carboxamide |
| SMILES | O=C(NO)C1=CNC(N2CC3CC(C2)CN(c2cc(C(F)(F)F)ccn2)C3)=NC1 |
| InChI | InChI=1S/C18H21F3N6O2/c19-18(20,21)14-1-2-22-15(4-14)26-7-11-3-12(8-26)10-27(9-11)17-23-5-13(6-24-17)16(28)25-29/h1-2,4-5,11-12,29H,3,6-10H2,(H,23,24)(H,25,28) |
| InChIKey | UOWPAKJRYWMQOO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|