C10H11N — CID 88870175
9-ethyl-7-azatricyclo[4.3.0.07,9]nona-1,3,5-triene (PubChem CID 88870175) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 9-ethyl-7-azatricyclo[4.3.0.07,9]nona-1,3,5-triene.
| Compound Name | 9-ethyl-7-azatricyclo[4.3.0.07,9]nona-1,3,5-triene |
|---|---|
| PubChem CID | 88870175 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 9-ethyl-7-azatricyclo[4.3.0.07,9]nona-1,3,5-triene |
| SMILES | CCC12CN1c1ccccc12 |
| InChI | InChI=1S/C10H11N/c1-2-10-7-11(10)9-6-4-3-5-8(9)10/h3-6H,2,7H2,1H3 |
| InChIKey | HIMLKQORQMBRQD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|