C16H31N3O2 — CID 88880713
4-amino-N-(2-ethyl-5-isocyanato-2,4,4-trimethylpentyl)-2-methylbutanamide (PubChem CID 88880713) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 4-amino-N-(2-ethyl-5-isocyanato-2,4,4-trimethylpentyl)-2-methylbutanamide.
| Compound Name | 4-amino-N-(2-ethyl-5-isocyanato-2,4,4-trimethylpentyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 88880713 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 4-amino-N-(2-ethyl-5-isocyanato-2,4,4-trimethylpentyl)-2-methylbutanamide |
| SMILES | CCC(C)(CNC(=O)C(C)CCN)CC(C)(C)CN=C=O |
| InChI | InChI=1S/C16H31N3O2/c1-6-16(5,9-15(3,4)10-18-12-20)11-19-14(21)13(2)7-8-17/h13H,6-11,17H2,1-5H3,(H,19,21) |
| InChIKey | KISGJXLDDBGTQZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|