C27H22N2O2S2 — CID 88886564
(2E)-2-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-2-[(Z)-(3-oxo-1H-inden-2-ylidene)-(prop-2-enylamino)methyl]sulfanylacetaldehyde (PubChem CID 88886564) has the molecular formula C27H22N2O2S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is (2E)-2-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-2-[(Z)-(3-oxo-1H-inden-2-ylidene)-(prop-2-enylamino)methyl]sulfanylacetaldehyde.
| Compound Name | (2E)-2-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-2-[(Z)-(3-oxo-1H-inden-2-ylidene)-(prop-2-enylamino)methyl]sulfanylacetaldehyde |
|---|---|
| PubChem CID | 88886564 |
| Molecular Formula | C27H22N2O2S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | (2E)-2-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-2-[(Z)-(3-oxo-1H-inden-2-ylidene)-(prop-2-enylamino)methyl]sulfanylacetaldehyde |
| SMILES | C=CCN/C(S/C(C=O)=C1/Sc2c(ccc3ccccc23)N1C)=C1\Cc2ccccc2C1=O |
| InChI | InChI=1S/C27H22N2O2S2/c1-3-14-28-26(21-15-18-9-5-6-10-19(18)24(21)31)32-23(16-30)27-29(2)22-13-12-17-8-4-7-11-20(17)25(22)33-27/h3-13,16,28H,1,14-15H2,2H3/b26-21-,27-23+ |
| InChIKey | LEWIBFJJJUKJBC-AFROTOFGSA-N |
| XLogP | 5.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|