C19H18N2OS3 — CID 147555196
(5Z)-5-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-3-(2-methylpropyl)-4-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 147555196) has the molecular formula C19H18N2OS3 and a molecular weight of 386.57 g/mol. Its IUPAC name is (5Z)-5-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-3-(2-methylpropyl)-4-sulfanylidene-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-5-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-3-(2-methylpropyl)-4-sulfanylidene-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 147555196 |
| Molecular Formula | C19H18N2OS3 |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | (5Z)-5-(3-methylbenzo[g][1,3]benzothiazol-2-ylidene)-3-(2-methylpropyl)-4-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | CC(C)CN1C(=O)S/C(=C2\Sc3c(ccc4ccccc34)N2C)C1=S |
| InChI | InChI=1S/C19H18N2OS3/c1-11(2)10-21-17(23)16(25-19(21)22)18-20(3)14-9-8-12-6-4-5-7-13(12)15(14)24-18/h4-9,11H,10H2,1-3H3/b18-16- |
| InChIKey | FRNSFNIGFVLZTD-VLGSPTGOSA-N |
| XLogP | 5.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|