C18H34N4O5 — CID 88890592
(Z)-[tert-butyl(methyl)amino]-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)carbamoyl]cyclohexyl]oxyimino-oxidoazanium (PubChem CID 88890592) has the molecular formula C18H34N4O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (Z)-[tert-butyl(methyl)amino]-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)carbamoyl]cyclohexyl]oxyimino-oxidoazanium.
| Compound Name | (Z)-[tert-butyl(methyl)amino]-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)carbamoyl]cyclohexyl]oxyimino-oxidoazanium |
|---|---|
| PubChem CID | 88890592 |
| Molecular Formula | C18H34N4O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (Z)-[tert-butyl(methyl)amino]-[4-[(1-methoxy-3-methyl-1-oxobutan-2-yl)carbamoyl]cyclohexyl]oxyimino-oxidoazanium |
| SMILES | COC(=O)C(NC(=O)C1CCC(O/N=[N+](\[O-])N(C)C(C)(C)C)CC1)C(C)C |
| InChI | InChI=1S/C18H34N4O5/c1-12(2)15(17(24)26-7)19-16(23)13-8-10-14(11-9-13)27-20-22(25)21(6)18(3,4)5/h12-15H,8-11H2,1-7H3,(H,19,23)/b22-20- |
| InChIKey | PZMCQZOGYZACRE-XDOYNYLZSA-N |
| XLogP | 2.40 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|