C23H42N4O6 — CID 172943103
(Z)-[tert-butyl(methyl)amino]-[4-[3-[(1-carboxy-2-methylpropyl)carbamoyl]-4-methylpentanoyl]cyclohexyl]oxyimino-oxidoazanium (PubChem CID 172943103) has the molecular formula C23H42N4O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is (Z)-[tert-butyl(methyl)amino]-[4-[3-[(1-carboxy-2-methylpropyl)carbamoyl]-4-methylpentanoyl]cyclohexyl]oxyimino-oxidoazanium.
| Compound Name | (Z)-[tert-butyl(methyl)amino]-[4-[3-[(1-carboxy-2-methylpropyl)carbamoyl]-4-methylpentanoyl]cyclohexyl]oxyimino-oxidoazanium |
|---|---|
| PubChem CID | 172943103 |
| Molecular Formula | C23H42N4O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | (Z)-[tert-butyl(methyl)amino]-[4-[3-[(1-carboxy-2-methylpropyl)carbamoyl]-4-methylpentanoyl]cyclohexyl]oxyimino-oxidoazanium |
| SMILES | CC(C)C(CC(=O)C1CCC(O/N=[N+](\[O-])N(C)C(C)(C)C)CC1)C(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C23H42N4O6/c1-14(2)18(21(29)24-20(15(3)4)22(30)31)13-19(28)16-9-11-17(12-10-16)33-25-27(32)26(8)23(5,6)7/h14-18,20H,9-13H2,1-8H3,(H,24,29)(H,30,31)/b27-25- |
| InChIKey | GZMTZALOTCNHAX-RFBIWTDZSA-N |
| XLogP | 3.54 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|