C19H36F3N4O6+ — CID 89421136
2-[4-[(Z)-[[tert-butyl(methyl)amino]-oxidoazaniumylidene]amino]oxycyclohexanecarbonyl]oxyethyl-trimethylazanium;2,2,2-trifluoroacetic acid (PubChem CID 89421136) has the molecular formula C19H36F3N4O6+ and a molecular weight of 473.51 g/mol. Its IUPAC name is 2-[4-[(Z)-[[tert-butyl(methyl)amino]-oxidoazaniumylidene]amino]oxycyclohexanecarbonyl]oxyethyl-trimethylazanium;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[(Z)-[[tert-butyl(methyl)amino]-oxidoazaniumylidene]amino]oxycyclohexanecarbonyl]oxyethyl-trimethylazanium;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 89421136 |
| Molecular Formula | C19H36F3N4O6+ |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | 2-[4-[(Z)-[[tert-butyl(methyl)amino]-oxidoazaniumylidene]amino]oxycyclohexanecarbonyl]oxyethyl-trimethylazanium;2,2,2-trifluoroacetic acid |
| SMILES | CN(/[N+]([O-])=N/OC1CCC(C(=O)OCC[N+](C)(C)C)CC1)C(C)(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H35N4O4.C2HF3O2/c1-17(2,3)19(4)20(23)18-25-15-10-8-14(9-11-15)16(22)24-13-12-21(5,6)7;3-2(4,5)1(6)7/h14-15H,8-13H2,1-7H3;(H,6,7)/q+1;/b20-18-; |
| InChIKey | REYNDROEJNSPME-GQQUDWLYSA-N |
| XLogP | 2.97 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|