C20H37F3N4O6 — CID 54674907
2-[4-[(E)-[[tert-butyl(ethyl)amino]-oxidoazaniumylidene]amino]oxycyclohexanecarbonyl]oxyethyl-trimethylazanium;2,2,2-trifluoroacetate (PubChem CID 54674907) has the molecular formula C20H37F3N4O6 and a molecular weight of 486.53 g/mol. Its IUPAC name is 2-[4-[(E)-[[tert-butyl(ethyl)amino]-oxidoazaniumylidene]amino]oxycyclohexanecarbonyl]oxyethyl-trimethylazanium;2,2,2-trifluoroacetate.
| Compound Name | 2-[4-[(E)-[[tert-butyl(ethyl)amino]-oxidoazaniumylidene]amino]oxycyclohexanecarbonyl]oxyethyl-trimethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 54674907 |
| Molecular Formula | C20H37F3N4O6 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 2-[4-[(E)-[[tert-butyl(ethyl)amino]-oxidoazaniumylidene]amino]oxycyclohexanecarbonyl]oxyethyl-trimethylazanium;2,2,2-trifluoroacetate |
| SMILES | CCN(/[N+]([O-])=N\OC1CCC(C(=O)OCC[N+](C)(C)C)CC1)C(C)(C)C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C18H37N4O4.C2HF3O2/c1-8-20(18(2,3)4)21(24)19-26-16-11-9-15(10-12-16)17(23)25-14-13-22(5,6)7;3-2(4,5)1(6)7/h15-16H,8-14H2,1-7H3;(H,6,7)/q+1;/p-1/b21-19+; |
| InChIKey | GJDNUGKJRFLHQS-UXJRWBAGSA-M |
| XLogP | 2.02 |
| TPSA | 117.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|