C14H19F3N2O4 — CID 146921339
2-(aminomethylidene)-3-(4-ethoxycarbonylcyclohexyl)imino-4,4,4-trifluorobutanoic acid (PubChem CID 146921339) has the molecular formula C14H19F3N2O4 and a molecular weight of 336.31 g/mol. Its IUPAC name is 2-(aminomethylidene)-3-(4-ethoxycarbonylcyclohexyl)imino-4,4,4-trifluorobutanoic acid.
| Compound Name | 2-(aminomethylidene)-3-(4-ethoxycarbonylcyclohexyl)imino-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 146921339 |
| Molecular Formula | C14H19F3N2O4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-(aminomethylidene)-3-(4-ethoxycarbonylcyclohexyl)imino-4,4,4-trifluorobutanoic acid |
| SMILES | CCOC(=O)C1CCC(/N=C(/C(=CN)C(=O)O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H19F3N2O4/c1-2-23-13(22)8-3-5-9(6-4-8)19-11(14(15,16)17)10(7-18)12(20)21/h7-9H,2-6,18H2,1H3,(H,20,21)/b10-7?,19-11- |
| InChIKey | JWHLVMILIZVNGD-OKKRTJNESA-N |
| XLogP | 2.04 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|