C27H32N4O4 — CID 88890911
N-hydroxy-3,3,5,5-tetramethyl-N'-[4-(quinolin-8-ylcarbamoyl)phenyl]heptanediamide (PubChem CID 88890911) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is N-hydroxy-3,3,5,5-tetramethyl-N'-[4-(quinolin-8-ylcarbamoyl)phenyl]heptanediamide.
| Compound Name | N-hydroxy-3,3,5,5-tetramethyl-N'-[4-(quinolin-8-ylcarbamoyl)phenyl]heptanediamide |
|---|---|
| PubChem CID | 88890911 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | N-hydroxy-3,3,5,5-tetramethyl-N'-[4-(quinolin-8-ylcarbamoyl)phenyl]heptanediamide |
| SMILES | CC(C)(CC(=O)NO)CC(C)(C)CC(=O)Nc1ccc(C(=O)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C27H32N4O4/c1-26(2,17-27(3,4)16-23(33)31-35)15-22(32)29-20-12-10-19(11-13-20)25(34)30-21-9-5-7-18-8-6-14-28-24(18)21/h5-14,35H,15-17H2,1-4H3,(H,29,32)(H,30,34)(H,31,33) |
| InChIKey | UDJUHQOSFUBMBX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|