C38H37FN6O5 — CID 123471924
N-[4-[2-fluoro-1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]cyclohexa-1,3-dien-5-yn-1-yl]-N'-hydroxy-3,3,5,5-tetramethylheptanediamide (PubChem CID 123471924) has the molecular formula C38H37FN6O5 and a molecular weight of 676.75 g/mol. Its IUPAC name is N-[4-[2-fluoro-1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]cyclohexa-1,3-dien-5-yn-1-yl]-N'-hydroxy-3,3,5,5-tetramethylheptanediamide.
| Compound Name | N-[4-[2-fluoro-1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]cyclohexa-1,3-dien-5-yn-1-yl]-N'-hydroxy-3,3,5,5-tetramethylheptanediamide |
|---|---|
| PubChem CID | 123471924 |
| Molecular Formula | C38H37FN6O5 |
| Molecular Weight | 676.75 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | N-[4-[2-fluoro-1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]cyclohexa-1,3-dien-5-yn-1-yl]-N'-hydroxy-3,3,5,5-tetramethylheptanediamide |
| SMILES | CC(C)(CC(=O)NO)CC(C)(C)CC(=O)Nc1c#cc(C(F)(C(=O)Nc2cccc3cccnc23)C(=O)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C38H37FN6O5/c1-36(2,23-37(3,4)22-31(47)45-50)21-30(46)42-27-17-15-26(16-18-27)38(39,34(48)43-28-13-5-9-24-11-7-19-40-32(24)28)35(49)44-29-14-6-10-25-12-8-20-41-33(25)29/h5-15,17,19-20,50H,21-23H2,1-4H3,(H,42,46)(H,43,48)(H,44,49)(H,45,47) |
| InChIKey | QHJBUDQTCJWASV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 162.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.75 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|