C36H36N6O6 — CID 88890912
N-hydroxy-N'-[4-[2-hydroxy-1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]phenyl]-3,5-dimethylheptanediamide (PubChem CID 88890912) has the molecular formula C36H36N6O6 and a molecular weight of 648.72 g/mol. Its IUPAC name is N-hydroxy-N'-[4-[2-hydroxy-1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]phenyl]-3,5-dimethylheptanediamide.
| Compound Name | N-hydroxy-N'-[4-[2-hydroxy-1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]phenyl]-3,5-dimethylheptanediamide |
|---|---|
| PubChem CID | 88890912 |
| Molecular Formula | C36H36N6O6 |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | N-hydroxy-N'-[4-[2-hydroxy-1,3-dioxo-1,3-bis(quinolin-8-ylamino)propan-2-yl]phenyl]-3,5-dimethylheptanediamide |
| SMILES | CC(CC(=O)NO)CC(C)CC(=O)Nc1ccc(C(O)(C(=O)Nc2cccc3cccnc23)C(=O)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C36H36N6O6/c1-22(19-23(2)21-31(44)42-48)20-30(43)39-27-15-13-26(14-16-27)36(47,34(45)40-28-11-3-7-24-9-5-17-37-32(24)28)35(46)41-29-12-4-8-25-10-6-18-38-33(25)29/h3-18,22-23,47-48H,19-21H2,1-2H3,(H,39,43)(H,40,45)(H,41,46)(H,42,44) |
| InChIKey | UDTGQOHCWBCDMA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 182.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|