C26H30N4O4 — CID 54674804
N'-hydroxy-N-[4-[1-oxo-1-(quinolin-8-ylamino)propan-2-yl]phenyl]octanediamide (PubChem CID 54674804) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[1-oxo-1-(quinolin-8-ylamino)propan-2-yl]phenyl]octanediamide.
| Compound Name | N'-hydroxy-N-[4-[1-oxo-1-(quinolin-8-ylamino)propan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 54674804 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N'-hydroxy-N-[4-[1-oxo-1-(quinolin-8-ylamino)propan-2-yl]phenyl]octanediamide |
| SMILES | CC(C(=O)Nc1cccc2cccnc12)c1ccc(NC(=O)CCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C26H30N4O4/c1-18(26(33)29-22-10-6-8-20-9-7-17-27-25(20)22)19-13-15-21(16-14-19)28-23(31)11-4-2-3-5-12-24(32)30-34/h6-10,13-18,34H,2-5,11-12H2,1H3,(H,28,31)(H,29,33)(H,30,32) |
| InChIKey | JPFRDKOIXLHYGZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|