C37H38N6O5 — CID 123640053
2-[4-[[7-(hydroxyamino)-2,2-dimethyl-7-oxoheptyl]carbamoyl]phenyl]-N,N'-di(quinolin-8-yl)propanediamide (PubChem CID 123640053) has the molecular formula C37H38N6O5 and a molecular weight of 646.75 g/mol. Its IUPAC name is 2-[4-[[7-(hydroxyamino)-2,2-dimethyl-7-oxoheptyl]carbamoyl]phenyl]-N,N'-di(quinolin-8-yl)propanediamide.
| Compound Name | 2-[4-[[7-(hydroxyamino)-2,2-dimethyl-7-oxoheptyl]carbamoyl]phenyl]-N,N'-di(quinolin-8-yl)propanediamide |
|---|---|
| PubChem CID | 123640053 |
| Molecular Formula | C37H38N6O5 |
| Molecular Weight | 646.75 g/mol |
| Exact Mass | 646.29 |
| IUPAC Name | 2-[4-[[7-(hydroxyamino)-2,2-dimethyl-7-oxoheptyl]carbamoyl]phenyl]-N,N'-di(quinolin-8-yl)propanediamide |
| SMILES | CC(C)(CCCCC(=O)NO)CNC(=O)c1ccc(C(C(=O)Nc2cccc3cccnc23)C(=O)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C37H38N6O5/c1-37(2,20-4-3-15-30(44)43-48)23-40-34(45)27-18-16-24(17-19-27)31(35(46)41-28-13-5-9-25-11-7-21-38-32(25)28)36(47)42-29-14-6-10-26-12-8-22-39-33(26)29/h5-14,16-19,21-22,31,48H,3-4,15,20,23H2,1-2H3,(H,40,45)(H,41,46)(H,42,47)(H,43,44) |
| InChIKey | YMKXUJZEGOYKQS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 162.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.75 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|