C21H21N3O2S — CID 89499160
4-tert-butyl-N-(quinolin-8-ylcarbamoyl)-N-sulfanylbenzamide (PubChem CID 89499160) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is 4-tert-butyl-N-(quinolin-8-ylcarbamoyl)-N-sulfanylbenzamide.
| Compound Name | 4-tert-butyl-N-(quinolin-8-ylcarbamoyl)-N-sulfanylbenzamide |
|---|---|
| PubChem CID | 89499160 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-tert-butyl-N-(quinolin-8-ylcarbamoyl)-N-sulfanylbenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N(S)C(=O)Nc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C21H21N3O2S/c1-21(2,3)16-11-9-15(10-12-16)19(25)24(27)20(26)23-17-8-4-6-14-7-5-13-22-18(14)17/h4-13,27H,1-3H3,(H,23,26) |
| InChIKey | OXRKOSAPTDRISF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|