C14H11NO4 — CID 88891446
N-(2,4-dihydroxyphenyl)-2-formylbenzamide (PubChem CID 88891446) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is N-(2,4-dihydroxyphenyl)-2-formylbenzamide.
| Compound Name | N-(2,4-dihydroxyphenyl)-2-formylbenzamide |
|---|---|
| PubChem CID | 88891446 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | N-(2,4-dihydroxyphenyl)-2-formylbenzamide |
| SMILES | O=Cc1ccccc1C(=O)Nc1ccc(O)cc1O |
| InChI | InChI=1S/C14H11NO4/c16-8-9-3-1-2-4-11(9)14(19)15-12-6-5-10(17)7-13(12)18/h1-8,17-18H,(H,15,19) |
| InChIKey | XYSGODLTUFUGMS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|