C9H16O3 — CID 88891624
[(4R,5S)-4,5-dimethyloxolan-2-yl]-(oxiran-2-yl)methanol (PubChem CID 88891624) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is [(4R,5S)-4,5-dimethyloxolan-2-yl]-(oxiran-2-yl)methanol.
| Compound Name | [(4R,5S)-4,5-dimethyloxolan-2-yl]-(oxiran-2-yl)methanol |
|---|---|
| PubChem CID | 88891624 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | [(4R,5S)-4,5-dimethyloxolan-2-yl]-(oxiran-2-yl)methanol |
| SMILES | C[C@@H]1CC(C(O)C2CO2)O[C@H]1C |
| InChI | InChI=1S/C9H16O3/c1-5-3-7(12-6(5)2)9(10)8-4-11-8/h5-10H,3-4H2,1-2H3/t5-,6+,7?,8?,9?/m1/s1 |
| InChIKey | TWCIMIRRZNZEEB-IEIIBKRVSA-N |
| XLogP | 0.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|