C18H14F3N3O2S — CID 88891991
2-[5-[2-(trifluoromethyl)benzoyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1,3-thiazole-5-carbaldehyde (PubChem CID 88891991) has the molecular formula C18H14F3N3O2S and a molecular weight of 393.39 g/mol. Its IUPAC name is 2-[5-[2-(trifluoromethyl)benzoyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[5-[2-(trifluoromethyl)benzoyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 88891991 |
| Molecular Formula | C18H14F3N3O2S |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 2-[5-[2-(trifluoromethyl)benzoyl]-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(N2CC3=C(CN(C(=O)c4ccccc4C(F)(F)F)C3)C2)s1 |
| InChI | InChI=1S/C18H14F3N3O2S/c19-18(20,21)15-4-2-1-3-14(15)16(26)23-6-11-8-24(9-12(11)7-23)17-22-5-13(10-25)27-17/h1-5,10H,6-9H2 |
| InChIKey | KZYXTOHMSSSCPS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|