C27H26BN3O2S2 — CID 88892887
CID 88892887 (PubChem CID 88892887) has the molecular formula C27H26BN3O2S2 and a molecular weight of 499.47 g/mol.
| Compound Name | CID 88892887 |
|---|---|
| PubChem CID | 88892887 |
| Molecular Formula | C27H26BN3O2S2 |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(S(=C)(=O)NC(C)(C)C(=O)Nc2nc(-c3ccccc3)c(Cc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C27H26BN3O2S2/c1-27(2,31-35(3,33)22-16-14-21(28)15-17-22)25(32)30-26-29-24(20-12-8-5-9-13-20)23(34-26)18-19-10-6-4-7-11-19/h4-17H,3,18H2,1-2H3,(H,31,33)(H,29,30,32) |
| InChIKey | CMDOLMGDCRNREE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|