C52H54O14 — CID 88894149
[4-[2-[4-[4-[1-[(2-methyloxiran-2-yl)methoxy]butoxy]benzoyl]oxybenzoyl]oxy-2-phenylethoxy]carbonylphenyl] 4-[1-[(2-methyloxiran-2-yl)methoxy]butoxy]benzoate (PubChem CID 88894149) has the molecular formula C52H54O14 and a molecular weight of 902.99 g/mol. Its IUPAC name is [4-[2-[4-[4-[1-[(2-methyloxiran-2-yl)methoxy]butoxy]benzoyl]oxybenzoyl]oxy-2-phenylethoxy]carbonylphenyl] 4-[1-[(2-methyloxiran-2-yl)methoxy]butoxy]benzoate.
| Compound Name | [4-[2-[4-[4-[1-[(2-methyloxiran-2-yl)methoxy]butoxy]benzoyl]oxybenzoyl]oxy-2-phenylethoxy]carbonylphenyl] 4-[1-[(2-methyloxiran-2-yl)methoxy]butoxy]benzoate |
|---|---|
| PubChem CID | 88894149 |
| Molecular Formula | C52H54O14 |
| Molecular Weight | 902.99 g/mol |
| Exact Mass | 902.35 |
| IUPAC Name | [4-[2-[4-[4-[1-[(2-methyloxiran-2-yl)methoxy]butoxy]benzoyl]oxybenzoyl]oxy-2-phenylethoxy]carbonylphenyl] 4-[1-[(2-methyloxiran-2-yl)methoxy]butoxy]benzoate |
| SMILES | CCCC(OCC1(C)CO1)Oc1ccc(C(=O)Oc2ccc(C(=O)OCC(OC(=O)c3ccc(OC(=O)c4ccc(OC(CCC)OCC5(C)CO5)cc4)cc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C52H54O14/c1-5-10-45(58-31-51(3)33-60-51)62-40-22-16-37(17-23-40)48(54)64-42-26-14-36(15-27-42)47(53)57-30-44(35-12-8-7-9-13-35)66-50(56)39-20-28-43(29-21-39)65-49(55)38-18-24-41(25-19-38)63-46(11-6-2)59-32-52(4)34-61-52/h7-9,12-29,44-46H,5-6,10-11,30-34H2,1-4H3 |
| InChIKey | FHZAHAKZPLSCEX-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 167.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.99 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|