C10H19NO6 — CID 88894432
2-[[2-amino-2-(hydroxymethyl)butoxy]methyl]butanedioic acid (PubChem CID 88894432) has the molecular formula C10H19NO6 and a molecular weight of 249.26 g/mol. Its IUPAC name is 2-[[2-amino-2-(hydroxymethyl)butoxy]methyl]butanedioic acid.
| Compound Name | 2-[[2-amino-2-(hydroxymethyl)butoxy]methyl]butanedioic acid |
|---|---|
| PubChem CID | 88894432 |
| Molecular Formula | C10H19NO6 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-[[2-amino-2-(hydroxymethyl)butoxy]methyl]butanedioic acid |
| SMILES | CCC(N)(CO)COCC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H19NO6/c1-2-10(11,5-12)6-17-4-7(9(15)16)3-8(13)14/h7,12H,2-6,11H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | RMCNENOGYADKKM-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |