C27H33N5O2 — CID 88895191
2-N-(5-ethynyl-4-methyl-2-propan-2-yloxyphenyl)-5-methyl-4-N-[2-[(propan-2-ylamino)oxymethyl]phenyl]pyrimidine-2,4-diamine (PubChem CID 88895191) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 2-N-(5-ethynyl-4-methyl-2-propan-2-yloxyphenyl)-5-methyl-4-N-[2-[(propan-2-ylamino)oxymethyl]phenyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(5-ethynyl-4-methyl-2-propan-2-yloxyphenyl)-5-methyl-4-N-[2-[(propan-2-ylamino)oxymethyl]phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 88895191 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 2-N-(5-ethynyl-4-methyl-2-propan-2-yloxyphenyl)-5-methyl-4-N-[2-[(propan-2-ylamino)oxymethyl]phenyl]pyrimidine-2,4-diamine |
| SMILES | C#Cc1cc(Nc2ncc(C)c(Nc3ccccc3CONC(C)C)n2)c(OC(C)C)cc1C |
| InChI | InChI=1S/C27H33N5O2/c1-8-21-14-24(25(13-19(21)6)34-18(4)5)30-27-28-15-20(7)26(31-27)29-23-12-10-9-11-22(23)16-33-32-17(2)3/h1,9-15,17-18,32H,16H2,2-7H3,(H2,28,29,30,31) |
| InChIKey | MBLQYHMPOQINEF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|