C4H8OS4 — CID 88897315
2-[1,2,2-tris(sulfanyl)ethenylsulfanyl]ethanol (PubChem CID 88897315) has the molecular formula C4H8OS4 and a molecular weight of 200.37 g/mol. Its IUPAC name is 2-[1,2,2-tris(sulfanyl)ethenylsulfanyl]ethanol.
| Compound Name | 2-[1,2,2-tris(sulfanyl)ethenylsulfanyl]ethanol |
|---|---|
| PubChem CID | 88897315 |
| Molecular Formula | C4H8OS4 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 199.95 |
| IUPAC Name | 2-[1,2,2-tris(sulfanyl)ethenylsulfanyl]ethanol |
| SMILES | OCCSC(S)=C(S)S |
| InChI | InChI=1S/C4H8OS4/c5-1-2-9-4(8)3(6)7/h5-8H,1-2H2 |
| InChIKey | WKIWQSKHZDVTRC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|