C10H13BIN3O — CID 88897667
CID 88897667 (PubChem CID 88897667) has the molecular formula C10H13BIN3O and a molecular weight of 328.95 g/mol.
| Compound Name | CID 88897667 |
|---|---|
| PubChem CID | 88897667 |
| Molecular Formula | C10H13BIN3O |
| Molecular Weight | 328.95 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | — |
| SMILES | [B]N1CCC(Oc2ncnc(I)c2C)CC1 |
| InChI | InChI=1S/C10H13BIN3O/c1-7-9(12)13-6-14-10(7)16-8-2-4-15(11)5-3-8/h6,8H,2-5H2,1H3 |
| InChIKey | JNYZXBORYYZFFZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.95 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|