C18H27ClO6 — CID 88899370
(8-methyl-3-oxo-2-oxabicyclo[4.3.1]decan-9-yl) 2-(2-chlorobutanoyloxy)butanoate (PubChem CID 88899370) has the molecular formula C18H27ClO6 and a molecular weight of 374.86 g/mol. Its IUPAC name is (8-methyl-3-oxo-2-oxabicyclo[4.3.1]decan-9-yl) 2-(2-chlorobutanoyloxy)butanoate.
| Compound Name | (8-methyl-3-oxo-2-oxabicyclo[4.3.1]decan-9-yl) 2-(2-chlorobutanoyloxy)butanoate |
|---|---|
| PubChem CID | 88899370 |
| Molecular Formula | C18H27ClO6 |
| Molecular Weight | 374.86 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (8-methyl-3-oxo-2-oxabicyclo[4.3.1]decan-9-yl) 2-(2-chlorobutanoyloxy)butanoate |
| SMILES | CCC(Cl)C(=O)OC(CC)C(=O)OC1C(C)CC2CCC(=O)OC1C2 |
| InChI | InChI=1S/C18H27ClO6/c1-4-12(19)17(21)24-13(5-2)18(22)25-16-10(3)8-11-6-7-15(20)23-14(16)9-11/h10-14,16H,4-9H2,1-3H3 |
| InChIKey | KKSCJHXLPVLALK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.86 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|