C17H23ClO6 — CID 88899227
[1-oxo-1-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]propan-2-yl] 2-chlorobutanoate (PubChem CID 88899227) has the molecular formula C17H23ClO6 and a molecular weight of 358.82 g/mol. Its IUPAC name is [1-oxo-1-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]propan-2-yl] 2-chlorobutanoate.
| Compound Name | [1-oxo-1-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]propan-2-yl] 2-chlorobutanoate |
|---|---|
| PubChem CID | 88899227 |
| Molecular Formula | C17H23ClO6 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | [1-oxo-1-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]propan-2-yl] 2-chlorobutanoate |
| SMILES | CCC(Cl)C(=O)OC(C)C(=O)OC1C2CC3CC(C2)C(=O)OC1C3 |
| InChI | InChI=1S/C17H23ClO6/c1-3-12(18)17(21)22-8(2)15(19)24-14-10-4-9-5-11(7-10)16(20)23-13(14)6-9/h8-14H,3-7H2,1-2H3 |
| InChIKey | KLPHSFNWIIUMMC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|