C12H15BrO4 — CID 88899730
(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl) 2-bromoacetate (PubChem CID 88899730) has the molecular formula C12H15BrO4 and a molecular weight of 303.15 g/mol. Its IUPAC name is (5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl) 2-bromoacetate.
| Compound Name | (5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl) 2-bromoacetate |
|---|---|
| PubChem CID | 88899730 |
| Molecular Formula | C12H15BrO4 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | (5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl) 2-bromoacetate |
| SMILES | O=C(CBr)OC1C2CC3CC(C2)C(=O)OC1C3 |
| InChI | InChI=1S/C12H15BrO4/c13-5-10(14)17-11-7-1-6-2-8(4-7)12(15)16-9(11)3-6/h6-9,11H,1-5H2 |
| InChIKey | VHBAHUQZNRLIBU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|