C11H15BrO3 — CID 89393676
2-(bromomethoxy)-4-oxatricyclo[4.3.1.13,8]undecan-5-one (PubChem CID 89393676) has the molecular formula C11H15BrO3 and a molecular weight of 275.14 g/mol. Its IUPAC name is 2-(bromomethoxy)-4-oxatricyclo[4.3.1.13,8]undecan-5-one.
| Compound Name | 2-(bromomethoxy)-4-oxatricyclo[4.3.1.13,8]undecan-5-one |
|---|---|
| PubChem CID | 89393676 |
| Molecular Formula | C11H15BrO3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-(bromomethoxy)-4-oxatricyclo[4.3.1.13,8]undecan-5-one |
| SMILES | O=C1OC2CC3CC1CC(C3)C2OCBr |
| InChI | InChI=1S/C11H15BrO3/c12-5-14-10-7-1-6-2-8(4-7)11(13)15-9(10)3-6/h6-10H,1-5H2 |
| InChIKey | CCAOMJGDSZBJMI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|