C17H22O7 — CID 160524642
1-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxycarbonyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 160524642) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is 1-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxycarbonyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 1-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxycarbonyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 160524642 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-[(5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxycarbonyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)OC(=O)OC1C2CC3CC(C2)C(=O)OC1C3 |
| InChI | InChI=1S/C17H22O7/c1-8(2)15(18)21-9(3)22-17(20)24-14-11-4-10-5-12(7-11)16(19)23-13(14)6-10/h9-14H,1,4-7H2,2-3H3 |
| InChIKey | WJYWFQNHCBEZLG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|