C18H28FN3 — CID 88900746
4-[(1E)-2-fluorobuta-1,3-dienyl]-8-(piperidin-4-ylmethyl)-2,8-diazaspiro[4.5]dec-3-ene (PubChem CID 88900746) has the molecular formula C18H28FN3 and a molecular weight of 305.44 g/mol. Its IUPAC name is 4-[(1E)-2-fluorobuta-1,3-dienyl]-8-(piperidin-4-ylmethyl)-2,8-diazaspiro[4.5]dec-3-ene.
| Compound Name | 4-[(1E)-2-fluorobuta-1,3-dienyl]-8-(piperidin-4-ylmethyl)-2,8-diazaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 88900746 |
| Molecular Formula | C18H28FN3 |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | 4-[(1E)-2-fluorobuta-1,3-dienyl]-8-(piperidin-4-ylmethyl)-2,8-diazaspiro[4.5]dec-3-ene |
| SMILES | C=C/C(F)=C\C1=CNCC12CCN(CC1CCNCC1)CC2 |
| InChI | InChI=1S/C18H28FN3/c1-2-17(19)11-16-12-21-14-18(16)5-9-22(10-6-18)13-15-3-7-20-8-4-15/h2,11-12,15,20-21H,1,3-10,13-14H2/b17-11+ |
| InChIKey | XEVAKTDJJMGOCC-GZTJUZNOSA-N |
| XLogP | 2.59 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|