C27H40N2 — CID 153383091
4-[(3E)-5,6-dimethylhepta-1,3,5-trien-3-yl]piperidine;(1Z)-N,N-dimethyl-1-(6-methylidene-3-prop-1-en-2-ylcyclohexa-2,4-dien-1-ylidene)methanamine (PubChem CID 153383091) has the molecular formula C27H40N2 and a molecular weight of 392.63 g/mol. Its IUPAC name is 4-[(3E)-5,6-dimethylhepta-1,3,5-trien-3-yl]piperidine;(1Z)-N,N-dimethyl-1-(6-methylidene-3-prop-1-en-2-ylcyclohexa-2,4-dien-1-ylidene)methanamine.
| Compound Name | 4-[(3E)-5,6-dimethylhepta-1,3,5-trien-3-yl]piperidine;(1Z)-N,N-dimethyl-1-(6-methylidene-3-prop-1-en-2-ylcyclohexa-2,4-dien-1-ylidene)methanamine |
|---|---|
| PubChem CID | 153383091 |
| Molecular Formula | C27H40N2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | 4-[(3E)-5,6-dimethylhepta-1,3,5-trien-3-yl]piperidine;(1Z)-N,N-dimethyl-1-(6-methylidene-3-prop-1-en-2-ylcyclohexa-2,4-dien-1-ylidene)methanamine |
| SMILES | C=C(C)c1ccc(=C)/c(=C\N(C)C)c1.C=C/C(=C\C(C)=C(C)C)C1CCNCC1 |
| InChI | InChI=1S/C14H23N.C13H17N/c1-5-13(10-12(4)11(2)3)14-6-8-15-9-7-14;1-10(2)12-7-6-11(3)13(8-12)9-14(4)5/h5,10,14-15H,1,6-9H2,2-4H3;6-9H,1,3H2,2,4-5H3/b13-10+;13-9- |
| InChIKey | CKOLCMDTKAZSNV-JQHJLEALSA-N |
| XLogP | 4.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|