C10H17BN4O2 — CID 88901306
CID 88901306 (PubChem CID 88901306) has the molecular formula C10H17BN4O2 and a molecular weight of 236.08 g/mol.
| Compound Name | CID 88901306 |
|---|---|
| PubChem CID | 88901306 |
| Molecular Formula | C10H17BN4O2 |
| Molecular Weight | 236.08 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | — |
| SMILES | [B]OC(CCCCNC(=O)n1ccnc1)NC |
| InChI | InChI=1S/C10H17BN4O2/c1-12-9(17-11)4-2-3-5-14-10(16)15-7-6-13-8-15/h6-9,12H,2-5H2,1H3,(H,14,16) |
| InChIKey | KPIVPIPXHFSSQH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.08 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|