C12H12ClNO6 — CID 88902144
2-[4-(chloroamino)phenyl]propane-1,2,3-tricarboxylic acid (PubChem CID 88902144) has the molecular formula C12H12ClNO6 and a molecular weight of 301.68 g/mol. Its IUPAC name is 2-[4-(chloroamino)phenyl]propane-1,2,3-tricarboxylic acid.
| Compound Name | 2-[4-(chloroamino)phenyl]propane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 88902144 |
| Molecular Formula | C12H12ClNO6 |
| Molecular Weight | 301.68 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 2-[4-(chloroamino)phenyl]propane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(CC(=O)O)(C(=O)O)c1ccc(NCl)cc1 |
| InChI | InChI=1S/C12H12ClNO6/c13-14-8-3-1-7(2-4-8)12(11(19)20,5-9(15)16)6-10(17)18/h1-4,14H,5-6H2,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | JOBKOJDZWBZFTA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.68 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|