C9H5ClF7N — CID 151001244
N-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline (PubChem CID 151001244) has the molecular formula C9H5ClF7N and a molecular weight of 295.59 g/mol. Its IUPAC name is N-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline.
| Compound Name | N-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline |
|---|---|
| PubChem CID | 151001244 |
| Molecular Formula | C9H5ClF7N |
| Molecular Weight | 295.59 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | N-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline |
| SMILES | FC(F)(F)C(F)(c1ccc(NCl)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H5ClF7N/c10-18-6-3-1-5(2-4-6)7(11,8(12,13)14)9(15,16)17/h1-4,18H |
| InChIKey | LUDKINPGWONREV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|