C17H13F7N2W — CID 166590161
[(3-amino-2-fluorophenyl)-[4-(1,1,1,2,3,3-hexafluorobutan-2-yl)anilino]methylidene]tungsten (PubChem CID 166590161) has the molecular formula C17H13F7N2W and a molecular weight of 562.13 g/mol. Its IUPAC name is [(3-amino-2-fluorophenyl)-[4-(1,1,1,2,3,3-hexafluorobutan-2-yl)anilino]methylidene]tungsten.
| Compound Name | [(3-amino-2-fluorophenyl)-[4-(1,1,1,2,3,3-hexafluorobutan-2-yl)anilino]methylidene]tungsten |
|---|---|
| PubChem CID | 166590161 |
| Molecular Formula | C17H13F7N2W |
| Molecular Weight | 562.13 g/mol |
| Exact Mass | 562.05 |
| IUPAC Name | [(3-amino-2-fluorophenyl)-[4-(1,1,1,2,3,3-hexafluorobutan-2-yl)anilino]methylidene]tungsten |
| SMILES | CC(F)(F)C(F)(c1ccc(NC(=[W])c2cccc(N)c2F)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H13F7N2.W/c1-15(19,20)16(21,17(22,23)24)11-5-7-12(8-6-11)26-9-10-3-2-4-13(25)14(10)18;/h2-8,26H,25H2,1H3; |
| InChIKey | GMEMGPYHEUXMER-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.13 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|