C20H15F13N2O — CID 163420083
3-amino-N-[2-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-2-fluorobenzamide (PubChem CID 163420083) has the molecular formula C20H15F13N2O and a molecular weight of 546.33 g/mol. Its IUPAC name is 3-amino-N-[2-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-2-fluorobenzamide.
| Compound Name | 3-amino-N-[2-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 163420083 |
| Molecular Formula | C20H15F13N2O |
| Molecular Weight | 546.33 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | 3-amino-N-[2-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]-2-fluorobenzamide |
| SMILES | CCC1=C(NC(=O)c2cccc(N)c2F)C(C(F)(F)F)CC(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)=C1 |
| InChI | InChI=1S/C20H15F13N2O/c1-2-8-6-9(16(22,19(28,29)30)18(26,27)20(31,32)33)7-11(17(23,24)25)14(8)35-15(36)10-4-3-5-12(34)13(10)21/h3-6,11H,2,7,34H2,1H3,(H,35,36) |
| InChIKey | AHSLGADCVBBLNP-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.33 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|