About chloromethane;N-chloro-4-methylaniline
chloromethane;N-chloro-4-methylaniline (PubChem CID 174858040) has the molecular formula C8H11Cl2N
and a molecular weight of 192.09 g/mol. Its IUPAC name is chloromethane;N-chloro-4-methylaniline.
Molecular Properties
| Compound Name | chloromethane;N-chloro-4-methylaniline |
| PubChem CID | 174858040 |
| Molecular Formula | C8H11Cl2N |
| Molecular Weight | 192.09 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | chloromethane;N-chloro-4-methylaniline |
| SMILES | CCl.Cc1ccc(NCl)cc1 |
| InChI | InChI=1S/C7H8ClN.CH3Cl/c1-6-2-4-7(9-8)5-3-6;1-2/h2-5,9H,1H3;1H3 |
| InChIKey | FKVULMKZBHDFIA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.09 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;N-chloro-4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;N-chloro-4-methylaniline?
The IUPAC name of chloromethane;N-chloro-4-methylaniline (CID 174858040) is chloromethane;N-chloro-4-methylaniline.
What is the SMILES notation for chloromethane;N-chloro-4-methylaniline?
The canonical SMILES for chloromethane;N-chloro-4-methylaniline is CCl.Cc1ccc(NCl)cc1.
What is the InChIKey of chloromethane;N-chloro-4-methylaniline?
The InChIKey is FKVULMKZBHDFIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN.CH3Cl/c1-6-2-4-7(9-8)5-3-6;1-2/h2-5,9H,1H3;1H3.
What are the key properties of chloromethane;N-chloro-4-methylaniline?
chloromethane;N-chloro-4-methylaniline has a molecular weight of 192.09 g/mol, XLogP of 3.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;N-chloro-4-methylaniline is sourced from PubChem (CID 174858040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).