About N-bromo-4-methylaniline;hydrochloride
N-bromo-4-methylaniline;hydrochloride (PubChem CID 175327592) has the molecular formula C7H9BrClN
and a molecular weight of 222.51 g/mol. Its IUPAC name is N-bromo-4-methylaniline;hydrochloride.
Molecular Properties
| Compound Name | N-bromo-4-methylaniline;hydrochloride |
| PubChem CID | 175327592 |
| Molecular Formula | C7H9BrClN |
| Molecular Weight | 222.51 g/mol |
| Exact Mass | 220.96 |
| IUPAC Name | N-bromo-4-methylaniline;hydrochloride |
| SMILES | Cc1ccc(NBr)cc1.Cl |
| InChI | InChI=1S/C7H8BrN.ClH/c1-6-2-4-7(9-8)5-3-6;/h2-5,9H,1H3;1H |
| InChIKey | GLOIUSOEDJDHNZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-bromo-4-methylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-bromo-4-methylaniline;hydrochloride?
The IUPAC name of N-bromo-4-methylaniline;hydrochloride (CID 175327592) is N-bromo-4-methylaniline;hydrochloride.
What is the SMILES notation for N-bromo-4-methylaniline;hydrochloride?
The canonical SMILES for N-bromo-4-methylaniline;hydrochloride is Cc1ccc(NBr)cc1.Cl.
What is the InChIKey of N-bromo-4-methylaniline;hydrochloride?
The InChIKey is GLOIUSOEDJDHNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrN.ClH/c1-6-2-4-7(9-8)5-3-6;/h2-5,9H,1H3;1H.
What are the key properties of N-bromo-4-methylaniline;hydrochloride?
N-bromo-4-methylaniline;hydrochloride has a molecular weight of 222.51 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-bromo-4-methylaniline;hydrochloride is sourced from PubChem (CID 175327592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).