C14H9Cl2F4N — CID 174671611
N-chloro-4-[1-(4-chlorophenyl)-1,2,2,2-tetrafluoroethyl]aniline (PubChem CID 174671611) has the molecular formula C14H9Cl2F4N and a molecular weight of 338.13 g/mol. Its IUPAC name is N-chloro-4-[1-(4-chlorophenyl)-1,2,2,2-tetrafluoroethyl]aniline.
| Compound Name | N-chloro-4-[1-(4-chlorophenyl)-1,2,2,2-tetrafluoroethyl]aniline |
|---|---|
| PubChem CID | 174671611 |
| Molecular Formula | C14H9Cl2F4N |
| Molecular Weight | 338.13 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | N-chloro-4-[1-(4-chlorophenyl)-1,2,2,2-tetrafluoroethyl]aniline |
| SMILES | FC(F)(F)C(F)(c1ccc(Cl)cc1)c1ccc(NCl)cc1 |
| InChI | InChI=1S/C14H9Cl2F4N/c15-11-5-1-9(2-6-11)13(17,14(18,19)20)10-3-7-12(21-16)8-4-10/h1-8,21H |
| InChIKey | AYXBXMRCGLXAKL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.13 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|